C21H24Cl2N4O3 — CID 120571381
5-(2,3-dimethylpiperazine-1-carbonyl)-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride (PubChem CID 120571381) has the molecular formula C21H24Cl2N4O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is 5-(2,3-dimethylpiperazine-1-carbonyl)-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride.
| Compound Name | 5-(2,3-dimethylpiperazine-1-carbonyl)-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 120571381 |
| Molecular Formula | C21H24Cl2N4O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 5-(2,3-dimethylpiperazine-1-carbonyl)-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride |
| SMILES | CC1NCCN(C(=O)c2ccc3c(c2)C(=O)N(Cc2ccncc2)C3=O)C1C.Cl.Cl |
| InChI | InChI=1S/C21H22N4O3.2ClH/c1-13-14(2)24(10-9-23-13)19(26)16-3-4-17-18(11-16)21(28)25(20(17)27)12-15-5-7-22-8-6-15;;/h3-8,11,13-14,23H,9-10,12H2,1-2H3;2*1H |
| InChIKey | IASZUZRSRLZFIH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|