C21H22Cl2N4O3 — CID 120656615
5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride (PubChem CID 120656615) has the molecular formula C21H22Cl2N4O3 and a molecular weight of 449.34 g/mol. Its IUPAC name is 5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride.
| Compound Name | 5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 120656615 |
| Molecular Formula | C21H22Cl2N4O3 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 5-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1ccc2c(c1)C(=O)N(Cc1ccncc1)C2=O)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C21H20N4O3.2ClH/c26-19(24-11-15-8-23-9-16(15)12-24)14-1-2-17-18(7-14)21(28)25(20(17)27)10-13-3-5-22-6-4-13;;/h1-7,15-16,23H,8-12H2;2*1H/t15-,16+;; |
| InChIKey | RVCJZRDEDWAZJZ-TYIJTUDGSA-N |
| XLogP | 2.01 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|