C24H25N3O3 — CID 9489440
5-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione (PubChem CID 9489440) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 5-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione.
| Compound Name | 5-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 9489440 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 5-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-2-(pyridin-4-ylmethyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccc(C(=O)N3CCC[C@H]4CCCC[C@@H]43)cc2C(=O)N1Cc1ccncc1 |
| InChI | InChI=1S/C24H25N3O3/c28-22(26-13-3-5-17-4-1-2-6-21(17)26)18-7-8-19-20(14-18)24(30)27(23(19)29)15-16-9-11-25-12-10-16/h7-12,14,17,21H,1-6,13,15H2/t17-,21+/m1/s1 |
| InChIKey | JOMYSISIGOXYIT-UTKZUKDTSA-N |
| XLogP | 3.67 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|