C23H25N3O3 — CID 119434913
5-[2-(1-aminoethyl)piperidine-1-carbonyl]-2-benzylisoindole-1,3-dione (PubChem CID 119434913) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 5-[2-(1-aminoethyl)piperidine-1-carbonyl]-2-benzylisoindole-1,3-dione.
| Compound Name | 5-[2-(1-aminoethyl)piperidine-1-carbonyl]-2-benzylisoindole-1,3-dione |
|---|---|
| PubChem CID | 119434913 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 5-[2-(1-aminoethyl)piperidine-1-carbonyl]-2-benzylisoindole-1,3-dione |
| SMILES | CC(N)C1CCCCN1C(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C23H25N3O3/c1-15(24)20-9-5-6-12-25(20)21(27)17-10-11-18-19(13-17)23(29)26(22(18)28)14-16-7-3-2-4-8-16/h2-4,7-8,10-11,13,15,20H,5-6,9,12,14,24H2,1H3 |
| InChIKey | UCXPYUHIZYEOKQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|