C21H24Cl2N4O3 — CID 120575696
N-(2-methylpiperidin-3-yl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide;dihydrochloride (PubChem CID 120575696) has the molecular formula C21H24Cl2N4O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is N-(2-methylpiperidin-3-yl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide;dihydrochloride.
| Compound Name | N-(2-methylpiperidin-3-yl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120575696 |
| Molecular Formula | C21H24Cl2N4O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-(2-methylpiperidin-3-yl)-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide;dihydrochloride |
| SMILES | CC1NCCCC1NC(=O)c1ccc2c(c1)C(=O)N(Cc1ccncc1)C2=O.Cl.Cl |
| InChI | InChI=1S/C21H22N4O3.2ClH/c1-13-18(3-2-8-23-13)24-19(26)15-4-5-16-17(11-15)21(28)25(20(16)27)12-14-6-9-22-10-7-14;;/h4-7,9-11,13,18,23H,2-3,8,12H2,1H3,(H,24,26);2*1H |
| InChIKey | AMPRYFRFGDIYSV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|