C24H19N3O4 — CID 31971686
N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide (PubChem CID 31971686) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 31971686 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-1,3-dioxo-2-(pyridin-4-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCOc2ccccc21)c1ccc2c(c1)C(=O)N(Cc1ccncc1)C2=O |
| InChI | InChI=1S/C24H19N3O4/c28-22(26-20-9-12-31-21-4-2-1-3-18(20)21)16-5-6-17-19(13-16)24(30)27(23(17)29)14-15-7-10-25-11-8-15/h1-8,10-11,13,20H,9,12,14H2,(H,26,28)/t20-/m1/s1 |
| InChIKey | FSLKAZOOOCYEGM-HXUWFJFHSA-N |
| XLogP | 3.13 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|