C22H21ClN2O5 — CID 108764717
N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108764717) has the molecular formula C22H21ClN2O5 and a molecular weight of 428.87 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108764717 |
| Molecular Formula | C22H21ClN2O5 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)NC3CCOc4ccc(Cl)cc43)cc2C1=O |
| InChI | InChI=1S/C22H21ClN2O5/c1-29-9-2-8-25-21(27)15-5-3-13(11-16(15)22(25)28)20(26)24-18-7-10-30-19-6-4-14(23)12-17(18)19/h3-6,11-12,18H,2,7-10H2,1H3,(H,24,26) |
| InChIKey | VNUPNRBMTXFXEJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|