C23H23ClN2O4 — CID 108764722
N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 108764722) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 108764722 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)NC1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H23ClN2O4/c24-15-9-10-20-18(14-15)19(11-13-30-20)25-21(27)8-2-1-5-12-26-22(28)16-6-3-4-7-17(16)23(26)29/h3-4,6-7,9-10,14,19H,1-2,5,8,11-13H2,(H,25,27) |
| InChIKey | YXYLZKGLGQGJAY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|