5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid

C14H17NO4 — CID 43580055

IUPAC5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid
SMILESO=C(O)CCCC(=O)NC1CCOc2ccccc21
InChIInChI=1S/C14H17NO4/c16-13(6-3-7-14(17)18)15-11-8-9-19-12-5-2-1-4-10(11)12/h1-2,4-5,11H,3,6-9H2,(H,15,16)(H,17,18)
InChIKeyLFKBLOFZQODSPO-UHFFFAOYSA-N
MW263.29 g/mol
LogP1.88
Rot. Bonds5

About 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid

5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid (PubChem CID 43580055) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid.

Molecular Properties

Compound Name5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid
PubChem CID43580055
Molecular FormulaC14H17NO4
Molecular Weight263.29 g/mol
Exact Mass263.12
IUPAC Name5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid
SMILESO=C(O)CCCC(=O)NC1CCOc2ccccc21
InChIInChI=1S/C14H17NO4/c16-13(6-3-7-14(17)18)15-11-8-9-19-12-5-2-1-4-10(11)12/h1-2,4-5,11H,3,6-9H2,(H,15,16)(H,17,18)
InChIKeyLFKBLOFZQODSPO-UHFFFAOYSA-N
XLogP1.88
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.29
LogP ≤ 51.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid?
The IUPAC name of 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid (CID 43580055) is 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid.
What is the SMILES notation for 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid?
The canonical SMILES for 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid is O=C(O)CCCC(=O)NC1CCOc2ccccc21.
What is the InChIKey of 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid?
The InChIKey is LFKBLOFZQODSPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c16-13(6-3-7-14(17)18)15-11-8-9-19-12-5-2-1-4-10(11)12/h1-2,4-5,11H,3,6-9H2,(H,15,16)(H,17,18).
What are the key properties of 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid?
5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid has a molecular weight of 263.29 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydro-2H-chromen-4-ylamino)-5-oxopentanoic acid is sourced from PubChem (CID 43580055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).