C19H18FNO3 — CID 18164395
N-(3,4-dihydro-2H-chromen-4-yl)-4-(4-fluorophenyl)-4-oxobutanamide (PubChem CID 18164395) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-4-(4-fluorophenyl)-4-oxobutanamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(4-fluorophenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 18164395 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-4-(4-fluorophenyl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C19H18FNO3/c20-14-7-5-13(6-8-14)17(22)9-10-19(23)21-16-11-12-24-18-4-2-1-3-15(16)18/h1-8,16H,9-12H2,(H,21,23) |
| InChIKey | AIOMVTKKBKRXNQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |