C23H22ClN3O6 — CID 108742214
N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 108742214) has the molecular formula C23H22ClN3O6 and a molecular weight of 471.90 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 108742214 |
| Molecular Formula | C23H22ClN3O6 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)-6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)NC1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H22ClN3O6/c24-14-8-9-19-16(13-14)17(10-12-33-19)25-20(28)7-2-1-3-11-26-22(29)15-5-4-6-18(27(31)32)21(15)23(26)30/h4-6,8-9,13,17H,1-3,7,10-12H2,(H,25,28) |
| InChIKey | AOIUSNGMJIKYEH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|