C21H26ClNO2 — CID 108764701
2-(1-adamantyl)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)acetamide (PubChem CID 108764701) has the molecular formula C21H26ClNO2 and a molecular weight of 359.90 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)acetamide.
| Compound Name | 2-(1-adamantyl)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)acetamide |
|---|---|
| PubChem CID | 108764701 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-(1-adamantyl)-N-(6-chloro-3,4-dihydro-2H-chromen-4-yl)acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NC1CCOc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H26ClNO2/c22-16-1-2-19-17(8-16)18(3-4-25-19)23-20(24)12-21-9-13-5-14(10-21)7-15(6-13)11-21/h1-2,8,13-15,18H,3-7,9-12H2,(H,23,24) |
| InChIKey | WHMUYSYXMAZWMQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |