C11H11BrClNO2 — CID 167888581
N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide (PubChem CID 167888581) has the molecular formula C11H11BrClNO2 and a molecular weight of 304.57 g/mol. Its IUPAC name is N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide.
| Compound Name | N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 167888581 |
| Molecular Formula | C11H11BrClNO2 |
| Molecular Weight | 304.57 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide |
| SMILES | O=C(CCl)N[C@H]1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H11BrClNO2/c12-7-1-2-10-8(5-7)9(3-4-16-10)14-11(15)6-13/h1-2,5,9H,3-4,6H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | KXADROLJRAFCCN-VIFPVBQESA-N |
| XLogP | 2.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|