About N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide
N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide (PubChem CID 167888581) has the molecular formula C11H11BrClNO2
and a molecular weight of 304.57 g/mol. Its IUPAC name is N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide.
Molecular Properties
| Compound Name | N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide |
| PubChem CID | 167888581 |
| Molecular Formula | C11H11BrClNO2 |
| Molecular Weight | 304.57 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide |
| SMILES | O=C(CCl)N[C@H]1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C11H11BrClNO2/c12-7-1-2-10-8(5-7)9(3-4-16-10)14-11(15)6-13/h1-2,5,9H,3-4,6H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | KXADROLJRAFCCN-VIFPVBQESA-N |
| XLogP | 2.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide?
The IUPAC name of N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide (CID 167888581) is N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide.
What is the SMILES notation for N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide?
The canonical SMILES for N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide is O=C(CCl)N[C@H]1CCOc2ccc(Br)cc21.
What is the InChIKey of N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide?
The InChIKey is KXADROLJRAFCCN-VIFPVBQESA-N. The full InChI is InChI=1S/C11H11BrClNO2/c12-7-1-2-10-8(5-7)9(3-4-16-10)14-11(15)6-13/h1-2,5,9H,3-4,6H2,(H,14,15)/t9-/m0/s1.
What are the key properties of N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide?
N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide has a molecular weight of 304.57 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4S)-6-bromo-3,4-dihydro-2H-chromen-4-yl]-2-chloroacetamide is sourced from PubChem (CID 167888581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).