C13H14ClNO3 — CID 82166058
N-[6-(2-chloroacetyl)-3,4-dihydro-2H-chromen-4-yl]acetamide (PubChem CID 82166058) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is N-[6-(2-chloroacetyl)-3,4-dihydro-2H-chromen-4-yl]acetamide.
| Compound Name | N-[6-(2-chloroacetyl)-3,4-dihydro-2H-chromen-4-yl]acetamide |
|---|---|
| PubChem CID | 82166058 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | N-[6-(2-chloroacetyl)-3,4-dihydro-2H-chromen-4-yl]acetamide |
| SMILES | CC(=O)NC1CCOc2ccc(C(=O)CCl)cc21 |
| InChI | InChI=1S/C13H14ClNO3/c1-8(16)15-11-4-5-18-13-3-2-9(6-10(11)13)12(17)7-14/h2-3,6,11H,4-5,7H2,1H3,(H,15,16) |
| InChIKey | SGZKSTXUVNWQGA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|