C18H26N2O2 — CID 82174592
N-[6-[amino(cyclohexyl)methyl]-3,4-dihydro-2H-chromen-4-yl]acetamide (PubChem CID 82174592) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[6-[amino(cyclohexyl)methyl]-3,4-dihydro-2H-chromen-4-yl]acetamide.
| Compound Name | N-[6-[amino(cyclohexyl)methyl]-3,4-dihydro-2H-chromen-4-yl]acetamide |
|---|---|
| PubChem CID | 82174592 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-[6-[amino(cyclohexyl)methyl]-3,4-dihydro-2H-chromen-4-yl]acetamide |
| SMILES | CC(=O)NC1CCOc2ccc(C(N)C3CCCCC3)cc21 |
| InChI | InChI=1S/C18H26N2O2/c1-12(21)20-16-9-10-22-17-8-7-14(11-15(16)17)18(19)13-5-3-2-4-6-13/h7-8,11,13,16,18H,2-6,9-10,19H2,1H3,(H,20,21) |
| InChIKey | RIAPCPNLWNIYHQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |