About 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide
3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide (PubChem CID 54935296) has the molecular formula C14H19BrN2O2
and a molecular weight of 327.22 g/mol. Its IUPAC name is 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide |
| PubChem CID | 54935296 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNC1CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H19BrN2O2/c1-17(2)14(18)5-7-16-12-6-8-19-13-4-3-10(15)9-11(12)13/h3-4,9,12,16H,5-8H2,1-2H3 |
| InChIKey | UOEAYKFRWRWQGO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide?
The IUPAC name of 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide (CID 54935296) is 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide.
What is the SMILES notation for 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide?
The canonical SMILES for 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide is CN(C)C(=O)CCNC1CCOc2ccc(Br)cc21.
What is the InChIKey of 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide?
The InChIKey is UOEAYKFRWRWQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN2O2/c1-17(2)14(18)5-7-16-12-6-8-19-13-4-3-10(15)9-11(12)13/h3-4,9,12,16H,5-8H2,1-2H3.
What are the key properties of 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide?
3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide has a molecular weight of 327.22 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-N,N-dimethylpropanamide is sourced from PubChem (CID 54935296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).