C18H25N4O4+ — CID 9205419
2-(3-methoxypropyl)-N-(4-methylpiperazin-4-ium-1-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 9205419) has the molecular formula C18H25N4O4+ and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-N-(4-methylpiperazin-4-ium-1-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(3-methoxypropyl)-N-(4-methylpiperazin-4-ium-1-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 9205419 |
| Molecular Formula | C18H25N4O4+ |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 2-(3-methoxypropyl)-N-(4-methylpiperazin-4-ium-1-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)NN3CC[NH+](C)CC3)cc2C1=O |
| InChI | InChI=1S/C18H24N4O4/c1-20-7-9-21(10-8-20)19-16(23)13-4-5-14-15(12-13)18(25)22(17(14)24)6-3-11-26-2/h4-5,12H,3,6-11H2,1-2H3,(H,19,23)/p+1 |
| InChIKey | HLAZEFXOGDGTQO-UHFFFAOYSA-O |
| XLogP | -1.21 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|