C24H24ClN3O5 — CID 55727336
N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55727336) has the molecular formula C24H24ClN3O5 and a molecular weight of 469.93 g/mol. Its IUPAC name is N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55727336 |
| Molecular Formula | C24H24ClN3O5 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[5-chloro-2-(pyrrolidine-1-carbonyl)phenyl]-2-(3-methoxypropyl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COCCCN1C(=O)c2ccc(C(=O)Nc3cc(Cl)ccc3C(=O)N3CCCC3)cc2C1=O |
| InChI | InChI=1S/C24H24ClN3O5/c1-33-12-4-11-28-23(31)17-7-5-15(13-19(17)24(28)32)21(29)26-20-14-16(25)6-8-18(20)22(30)27-9-2-3-10-27/h5-8,13-14H,2-4,9-12H2,1H3,(H,26,29) |
| InChIKey | JKQVLHILJJNHOZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|