C21H19N3O5 — CID 42897100
2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide (PubChem CID 42897100) has the molecular formula C21H19N3O5 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide.
| Compound Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide |
|---|---|
| PubChem CID | 42897100 |
| Molecular Formula | C21H19N3O5 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 2-(3-benzyl-2,4,5-trioxoimidazolidin-1-yl)-N-(3,4-dihydro-2H-chromen-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)N(Cc2ccccc2)C1=O)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C21H19N3O5/c25-18(22-16-10-11-29-17-9-5-4-8-15(16)17)13-24-20(27)19(26)23(21(24)28)12-14-6-2-1-3-7-14/h1-9,16H,10-13H2,(H,22,25) |
| InChIKey | RKRIEMIUSITRRH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|