C23H26ClN3O3 — CID 119609641
N-[2-(aminomethyl)cyclohexyl]-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride (PubChem CID 119609641) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119609641 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C23H25N3O3.ClH/c24-13-17-8-4-5-9-20(17)25-21(27)16-10-11-18-19(12-16)23(29)26(22(18)28)14-15-6-2-1-3-7-15;/h1-3,6-7,10-12,17,20H,4-5,8-9,13-14,24H2,(H,25,27);1H |
| InChIKey | FLVOUZYTTNLQMX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|