C19H26ClN3O3 — CID 119610634
N-[2-(aminomethyl)cyclohexyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride (PubChem CID 119610634) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119610634 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C19H25N3O3.ClH/c20-11-15-3-1-2-4-16(15)21-19(25)14-7-5-13(6-8-14)12-22-17(23)9-10-18(22)24;/h5-8,15-16H,1-4,9-12,20H2,(H,21,25);1H |
| InChIKey | XXDXQVOMNJTEQN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|