C18H27ClN2OS2 — CID 119610012
N-[2-(aminomethyl)cyclohexyl]-4-(1,3-dithian-2-yl)benzamide;hydrochloride (PubChem CID 119610012) has the molecular formula C18H27ClN2OS2 and a molecular weight of 387.01 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-(1,3-dithian-2-yl)benzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-(1,3-dithian-2-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119610012 |
| Molecular Formula | C18H27ClN2OS2 |
| Molecular Weight | 387.01 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-(1,3-dithian-2-yl)benzamide;hydrochloride |
| SMILES | Cl.NCC1CCCCC1NC(=O)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C18H26N2OS2.ClH/c19-12-15-4-1-2-5-16(15)20-17(21)13-6-8-14(9-7-13)18-22-10-3-11-23-18;/h6-9,15-16,18H,1-5,10-12,19H2,(H,20,21);1H |
| InChIKey | VLIVRVQQIGGNCH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |