C15H19F3N2OS — CID 119611041
N-[2-(aminomethyl)cyclohexyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 119611041) has the molecular formula C15H19F3N2OS and a molecular weight of 332.39 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 119611041 |
| Molecular Formula | C15H19F3N2OS |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | NCC1CCCCC1NC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2OS/c16-15(17,18)22-12-7-5-10(6-8-12)14(21)20-13-4-2-1-3-11(13)9-19/h5-8,11,13H,1-4,9,19H2,(H,20,21) |
| InChIKey | GZWICEOTHYFKGH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |