C17H25ClN2OS2 — CID 120554586
4-(1,3-dithian-2-yl)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride (PubChem CID 120554586) has the molecular formula C17H25ClN2OS2 and a molecular weight of 372.99 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride.
| Compound Name | 4-(1,3-dithian-2-yl)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120554586 |
| Molecular Formula | C17H25ClN2OS2 |
| Molecular Weight | 372.99 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-(3-methylpiperidin-4-yl)benzamide;hydrochloride |
| SMILES | CC1CNCCC1NC(=O)c1ccc(C2SCCCS2)cc1.Cl |
| InChI | InChI=1S/C17H24N2OS2.ClH/c1-12-11-18-8-7-15(12)19-16(20)13-3-5-14(6-4-13)17-21-9-2-10-22-17;/h3-6,12,15,17-18H,2,7-11H2,1H3,(H,19,20);1H |
| InChIKey | TYPFBHJZXMPJOH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |