C21H22ClN3O3 — CID 119613437
N-(2-amino-1-cyclopropylethyl)-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride (PubChem CID 119613437) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119613437 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-2-benzyl-1,3-dioxoisoindole-5-carboxamide;hydrochloride |
| SMILES | Cl.NCC(NC(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O)C1CC1 |
| InChI | InChI=1S/C21H21N3O3.ClH/c22-11-18(14-6-7-14)23-19(25)15-8-9-16-17(10-15)21(27)24(20(16)26)12-13-4-2-1-3-5-13;/h1-5,8-10,14,18H,6-7,11-12,22H2,(H,23,25);1H |
| InChIKey | LSSZDYUANWEGSM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|