C22H26N2O5 — CID 119168938
1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 119168938) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | 1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 119168938 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(2-butyl-1,3-dioxoisoindole-5-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3C(C(=O)O)CC4CCCCC43)cc2C1=O |
| InChI | InChI=1S/C22H26N2O5/c1-2-3-10-23-20(26)15-9-8-14(11-16(15)21(23)27)19(25)24-17-7-5-4-6-13(17)12-18(24)22(28)29/h8-9,11,13,17-18H,2-7,10,12H2,1H3,(H,28,29) |
| InChIKey | DUXRIMRPGNOXKP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|