C20H27N3O3 — CID 119595940
5-[3-(1-aminoethyl)piperidine-1-carbonyl]-2-butylisoindole-1,3-dione (PubChem CID 119595940) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 5-[3-(1-aminoethyl)piperidine-1-carbonyl]-2-butylisoindole-1,3-dione.
| Compound Name | 5-[3-(1-aminoethyl)piperidine-1-carbonyl]-2-butylisoindole-1,3-dione |
|---|---|
| PubChem CID | 119595940 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 5-[3-(1-aminoethyl)piperidine-1-carbonyl]-2-butylisoindole-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3CCCC(C(C)N)C3)cc2C1=O |
| InChI | InChI=1S/C20H27N3O3/c1-3-4-10-23-19(25)16-8-7-14(11-17(16)20(23)26)18(24)22-9-5-6-15(12-22)13(2)21/h7-8,11,13,15H,3-6,9-10,12,21H2,1-2H3 |
| InChIKey | HEKMLIRSIWCTHS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|