C20H26N2O4 — CID 75392247
2-butyl-5-[2-(3-hydroxypropyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione (PubChem CID 75392247) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-butyl-5-[2-(3-hydroxypropyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-butyl-5-[2-(3-hydroxypropyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 75392247 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-butyl-5-[2-(3-hydroxypropyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3CCCC3CCCO)cc2C1=O |
| InChI | InChI=1S/C20H26N2O4/c1-2-3-10-22-19(25)16-9-8-14(13-17(16)20(22)26)18(24)21-11-4-6-15(21)7-5-12-23/h8-9,13,15,23H,2-7,10-12H2,1H3 |
| InChIKey | HJHNCTVAKXZMPR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|