C25H28N2O5 — CID 42026157
2-butyl-5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione (PubChem CID 42026157) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-butyl-5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-butyl-5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42026157 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-butyl-5-[(2R)-2-(2,4-dimethoxyphenyl)pyrrolidine-1-carbonyl]isoindole-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3CCC[C@@H]3c3ccc(OC)cc3OC)cc2C1=O |
| InChI | InChI=1S/C25H28N2O5/c1-4-5-12-27-24(29)18-10-8-16(14-20(18)25(27)30)23(28)26-13-6-7-21(26)19-11-9-17(31-2)15-22(19)32-3/h8-11,14-15,21H,4-7,12-13H2,1-3H3/t21-/m1/s1 |
| InChIKey | LJNCICHFFLJNLF-OAQYLSRUSA-N |
| XLogP | 4.08 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|