C24H23Cl2N3O4 — CID 55556726
2-butyl-5-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 55556726) has the molecular formula C24H23Cl2N3O4 and a molecular weight of 488.37 g/mol. Its IUPAC name is 2-butyl-5-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-butyl-5-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55556726 |
| Molecular Formula | C24H23Cl2N3O4 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-butyl-5-[4-(3,5-dichlorobenzoyl)piperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)N3CCN(C(=O)c4cc(Cl)cc(Cl)c4)CC3)cc2C1=O |
| InChI | InChI=1S/C24H23Cl2N3O4/c1-2-3-6-29-23(32)19-5-4-15(13-20(19)24(29)33)21(30)27-7-9-28(10-8-27)22(31)16-11-17(25)14-18(26)12-16/h4-5,11-14H,2-3,6-10H2,1H3 |
| InChIKey | JKMMBFDWMJQOKD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|