C17H20N2O4 — CID 136581210
2-methyl-5-[(5S)-2,2,5-trimethylmorpholine-4-carbonyl]isoindole-1,3-dione (PubChem CID 136581210) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-methyl-5-[(5S)-2,2,5-trimethylmorpholine-4-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[(5S)-2,2,5-trimethylmorpholine-4-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 136581210 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-methyl-5-[(5S)-2,2,5-trimethylmorpholine-4-carbonyl]isoindole-1,3-dione |
| SMILES | C[C@H]1COC(C)(C)CN1C(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C17H20N2O4/c1-10-8-23-17(2,3)9-19(10)14(20)11-5-6-12-13(7-11)16(22)18(4)15(12)21/h5-7,10H,8-9H2,1-4H3/t10-/m0/s1 |
| InChIKey | YSSHMNSTQLNSCV-JTQLQIEISA-N |
| XLogP | 1.55 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|