C17H24N2O2 — CID 124864128
5-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1,2-dimethylpyridin-4-one (PubChem CID 124864128) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1,2-dimethylpyridin-4-one.
| Compound Name | 5-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1,2-dimethylpyridin-4-one |
|---|---|
| PubChem CID | 124864128 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 5-[(2R,3aR,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1,2-dimethylpyridin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)N2[C@H](C)C[C@H]3CCCC[C@H]32)cn1C |
| InChI | InChI=1S/C17H24N2O2/c1-11-9-16(20)14(10-18(11)3)17(21)19-12(2)8-13-6-4-5-7-15(13)19/h9-10,12-13,15H,4-8H2,1-3H3/t12-,13-,15-/m1/s1 |
| InChIKey | WRQJJRGPWSJKCW-UMVBOHGHSA-N |
| XLogP | 2.49 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |