C15H26N2O — CID 124861773
[(2R,3aS,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,3R)-3-aminocyclopentyl]methanone (PubChem CID 124861773) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is [(2R,3aS,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,3R)-3-aminocyclopentyl]methanone.
| Compound Name | [(2R,3aS,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,3R)-3-aminocyclopentyl]methanone |
|---|---|
| PubChem CID | 124861773 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | [(2R,3aS,7aS)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-[(1S,3R)-3-aminocyclopentyl]methanone |
| SMILES | C[C@@H]1C[C@@H]2CCCC[C@@H]2N1C(=O)[C@H]1CC[C@@H](N)C1 |
| InChI | InChI=1S/C15H26N2O/c1-10-8-11-4-2-3-5-14(11)17(10)15(18)12-6-7-13(16)9-12/h10-14H,2-9,16H2,1H3/t10-,11+,12+,13-,14+/m1/s1 |
| InChIKey | JOKQOQFXHCACIU-HTOAHKCRSA-N |
| XLogP | 2.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |