C16H23F3N2O2 — CID 124731997
(4S)-4-[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one (PubChem CID 124731997) has the molecular formula C16H23F3N2O2 and a molecular weight of 332.37 g/mol. Its IUPAC name is (4S)-4-[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one.
| Compound Name | (4S)-4-[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 124731997 |
| Molecular Formula | C16H23F3N2O2 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (4S)-4-[(2R,3aS,7aR)-2-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carbonyl]-1-(2,2,2-trifluoroethyl)pyrrolidin-2-one |
| SMILES | C[C@@H]1C[C@@H]2CCCC[C@H]2N1C(=O)[C@H]1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H23F3N2O2/c1-10-6-11-4-2-3-5-13(11)21(10)15(23)12-7-14(22)20(8-12)9-16(17,18)19/h10-13H,2-9H2,1H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | JHCPKGGXPHUXQJ-MROQNXINSA-N |
| XLogP | 2.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |