C11H18N2O3 — CID 174939125
1-(4-methylmorpholin-2-yl)prop-2-en-1-one;prop-2-enamide (PubChem CID 174939125) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(4-methylmorpholin-2-yl)prop-2-en-1-one;prop-2-enamide.
| Compound Name | 1-(4-methylmorpholin-2-yl)prop-2-en-1-one;prop-2-enamide |
|---|---|
| PubChem CID | 174939125 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-(4-methylmorpholin-2-yl)prop-2-en-1-one;prop-2-enamide |
| SMILES | C=CC(=O)C1CN(C)CCO1.C=CC(N)=O |
| InChI | InChI=1S/C8H13NO2.C3H5NO/c1-3-7(10)8-6-9(2)4-5-11-8;1-2-3(4)5/h3,8H,1,4-6H2,2H3;2H,1H2,(H2,4,5) |
| InChIKey | FWNYYSZDCWXXJF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|