C8H19NO2 — CID 169236342
ethane;4-methyl-1,4-oxazepan-6-ol (PubChem CID 169236342) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is ethane;4-methyl-1,4-oxazepan-6-ol.
| Compound Name | ethane;4-methyl-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 169236342 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | ethane;4-methyl-1,4-oxazepan-6-ol |
| SMILES | CC.CN1CCOCC(O)C1 |
| InChI | InChI=1S/C6H13NO2.C2H6/c1-7-2-3-9-5-6(8)4-7;1-2/h6,8H,2-5H2,1H3;1-2H3 |
| InChIKey | LVZKTCRUSLKJQW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |