C6H12N2O3 — CID 130942569
6-hydroxy-1,4-oxazepane-4-carboxamide (PubChem CID 130942569) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is 6-hydroxy-1,4-oxazepane-4-carboxamide.
| Compound Name | 6-hydroxy-1,4-oxazepane-4-carboxamide |
|---|---|
| PubChem CID | 130942569 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | 6-hydroxy-1,4-oxazepane-4-carboxamide |
| SMILES | NC(=O)N1CCOCC(O)C1 |
| InChI | InChI=1S/C6H12N2O3/c7-6(10)8-1-2-11-4-5(9)3-8/h5,9H,1-4H2,(H2,7,10) |
| InChIKey | WQOVPXUPGIGKNS-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |