morpholine-4-carbonyl chloride;morpholine-4-carboxamide

C10H18ClN3O4 — CID 160802379

IUPACmorpholine-4-carbonyl chloride;morpholine-4-carboxamide
SMILESNC(=O)N1CCOCC1.O=C(Cl)N1CCOCC1
InChIInChI=1S/C5H8ClNO2.C5H10N2O2/c2*6-5(8)7-1-3-9-4-2-7/h1-4H2;1-4H2,(H2,6,8)
InChIKeySDGFDGOABUMWPR-UHFFFAOYSA-N
MW279.72 g/mol
LogP0.07
Rot. Bonds

About morpholine-4-carbonyl chloride;morpholine-4-carboxamide

morpholine-4-carbonyl chloride;morpholine-4-carboxamide (PubChem CID 160802379) has the molecular formula C10H18ClN3O4 and a molecular weight of 279.72 g/mol. Its IUPAC name is morpholine-4-carbonyl chloride;morpholine-4-carboxamide.

Molecular Properties

Compound Namemorpholine-4-carbonyl chloride;morpholine-4-carboxamide
PubChem CID160802379
Molecular FormulaC10H18ClN3O4
Molecular Weight279.72 g/mol
Exact Mass279.10
IUPAC Namemorpholine-4-carbonyl chloride;morpholine-4-carboxamide
SMILESNC(=O)N1CCOCC1.O=C(Cl)N1CCOCC1
InChIInChI=1S/C5H8ClNO2.C5H10N2O2/c2*6-5(8)7-1-3-9-4-2-7/h1-4H2;1-4H2,(H2,6,8)
InChIKeySDGFDGOABUMWPR-UHFFFAOYSA-N
XLogP0.07
TPSA85.10 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.72
LogP ≤ 50.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze morpholine-4-carbonyl chloride;morpholine-4-carboxamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
The IUPAC name of morpholine-4-carbonyl chloride;morpholine-4-carboxamide (CID 160802379) is morpholine-4-carbonyl chloride;morpholine-4-carboxamide.
What is the SMILES notation for morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
The canonical SMILES for morpholine-4-carbonyl chloride;morpholine-4-carboxamide is NC(=O)N1CCOCC1.O=C(Cl)N1CCOCC1.
What is the InChIKey of morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
The InChIKey is SDGFDGOABUMWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClNO2.C5H10N2O2/c2*6-5(8)7-1-3-9-4-2-7/h1-4H2;1-4H2,(H2,6,8).
What are the key properties of morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
morpholine-4-carbonyl chloride;morpholine-4-carboxamide has a molecular weight of 279.72 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carbonyl chloride;morpholine-4-carboxamide is sourced from PubChem (CID 160802379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).