About morpholine-4-carbonyl chloride;morpholine-4-carboxamide
morpholine-4-carbonyl chloride;morpholine-4-carboxamide (PubChem CID 160802379) has the molecular formula C10H18ClN3O4
and a molecular weight of 279.72 g/mol. Its IUPAC name is morpholine-4-carbonyl chloride;morpholine-4-carboxamide.
Molecular Properties
| Compound Name | morpholine-4-carbonyl chloride;morpholine-4-carboxamide |
| PubChem CID | 160802379 |
| Molecular Formula | C10H18ClN3O4 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | morpholine-4-carbonyl chloride;morpholine-4-carboxamide |
| SMILES | NC(=O)N1CCOCC1.O=C(Cl)N1CCOCC1 |
| InChI | InChI=1S/C5H8ClNO2.C5H10N2O2/c2*6-5(8)7-1-3-9-4-2-7/h1-4H2;1-4H2,(H2,6,8) |
| InChIKey | SDGFDGOABUMWPR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze morpholine-4-carbonyl chloride;morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
The IUPAC name of morpholine-4-carbonyl chloride;morpholine-4-carboxamide (CID 160802379) is morpholine-4-carbonyl chloride;morpholine-4-carboxamide.
What is the SMILES notation for morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
The canonical SMILES for morpholine-4-carbonyl chloride;morpholine-4-carboxamide is NC(=O)N1CCOCC1.O=C(Cl)N1CCOCC1.
What is the InChIKey of morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
The InChIKey is SDGFDGOABUMWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClNO2.C5H10N2O2/c2*6-5(8)7-1-3-9-4-2-7/h1-4H2;1-4H2,(H2,6,8).
What are the key properties of morpholine-4-carbonyl chloride;morpholine-4-carboxamide?
morpholine-4-carbonyl chloride;morpholine-4-carboxamide has a molecular weight of 279.72 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carbonyl chloride;morpholine-4-carboxamide is sourced from PubChem (CID 160802379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).