C8H14N2O2 — CID 171431414
2-(1,4-oxazepan-4-yl)prop-2-enamide (PubChem CID 171431414) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(1,4-oxazepan-4-yl)prop-2-enamide.
| Compound Name | 2-(1,4-oxazepan-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171431414 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-(1,4-oxazepan-4-yl)prop-2-enamide |
| SMILES | C=C(C(N)=O)N1CCCOCC1 |
| InChI | InChI=1S/C8H14N2O2/c1-7(8(9)11)10-3-2-5-12-6-4-10/h1-6H2,(H2,9,11) |
| InChIKey | DFTISKNDFRMBFH-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|