C7H15N5O — CID 83037181
N-(diaminomethylidene)-1,4-oxazepane-4-carboximidamide (PubChem CID 83037181) has the molecular formula C7H15N5O and a molecular weight of 185.23 g/mol. Its IUPAC name is N-(diaminomethylidene)-1,4-oxazepane-4-carboximidamide.
| Compound Name | N-(diaminomethylidene)-1,4-oxazepane-4-carboximidamide |
|---|---|
| PubChem CID | 83037181 |
| Molecular Formula | C7H15N5O |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | N-(diaminomethylidene)-1,4-oxazepane-4-carboximidamide |
| SMILES | [H]/N=C(\N=C(N)N)N1CCCOCC1 |
| InChI | InChI=1S/C7H15N5O/c8-6(9)11-7(10)12-2-1-4-13-5-3-12/h1-5H2,(H5,8,9,10,11) |
| InChIKey | WCGFKIVAFLDMDB-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|