C9H16N2O — CID 63181568
cyclopropyl(1,4-oxazepan-4-yl)methanimine (PubChem CID 63181568) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is cyclopropyl(1,4-oxazepan-4-yl)methanimine.
| Compound Name | cyclopropyl(1,4-oxazepan-4-yl)methanimine |
|---|---|
| PubChem CID | 63181568 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | cyclopropyl(1,4-oxazepan-4-yl)methanimine |
| SMILES | [H]/N=C(\C1CC1)N1CCCOCC1 |
| InChI | InChI=1S/C9H16N2O/c10-9(8-2-3-8)11-4-1-6-12-7-5-11/h8,10H,1-7H2/b10-9+ |
| InChIKey | DQTLTQSSAAOMLI-MDZDMXLPSA-N |
| XLogP | 1.10 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|