C10H18N2S2 — CID 130616752
cyclopentyl(1,2,5-dithiazepan-5-yl)methanimine (PubChem CID 130616752) has the molecular formula C10H18N2S2 and a molecular weight of 230.40 g/mol. Its IUPAC name is cyclopentyl(1,2,5-dithiazepan-5-yl)methanimine.
| Compound Name | cyclopentyl(1,2,5-dithiazepan-5-yl)methanimine |
|---|---|
| PubChem CID | 130616752 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | cyclopentyl(1,2,5-dithiazepan-5-yl)methanimine |
| SMILES | [H]/N=C(\C1CCCC1)N1CCSSCC1 |
| InChI | InChI=1S/C10H18N2S2/c11-10(9-3-1-2-4-9)12-5-7-13-14-8-6-12/h9,11H,1-8H2/b11-10+ |
| InChIKey | DWZWFMSLVAFFAF-ZHACJKMWSA-N |
| XLogP | 2.85 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|