C17H24N2 — CID 63175688
cyclohexyl-(3-phenylpyrrolidin-1-yl)methanimine (PubChem CID 63175688) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is cyclohexyl-(3-phenylpyrrolidin-1-yl)methanimine.
| Compound Name | cyclohexyl-(3-phenylpyrrolidin-1-yl)methanimine |
|---|---|
| PubChem CID | 63175688 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | cyclohexyl-(3-phenylpyrrolidin-1-yl)methanimine |
| SMILES | [H]/N=C(\C1CCCCC1)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C17H24N2/c18-17(15-9-5-2-6-10-15)19-12-11-16(13-19)14-7-3-1-4-8-14/h1,3-4,7-8,15-16,18H,2,5-6,9-13H2/b18-17+ |
| InChIKey | FILLQQJKMZBNCP-ISLYRVAYSA-N |
| XLogP | 4.03 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|