C18H27N3 — CID 63178264
(4-benzylpiperazin-1-yl)-cyclohexylmethanimine (PubChem CID 63178264) has the molecular formula C18H27N3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-cyclohexylmethanimine.
| Compound Name | (4-benzylpiperazin-1-yl)-cyclohexylmethanimine |
|---|---|
| PubChem CID | 63178264 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-cyclohexylmethanimine |
| SMILES | [H]/N=C(\C1CCCCC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3/c19-18(17-9-5-2-6-10-17)21-13-11-20(12-14-21)15-16-7-3-1-4-8-16/h1,3-4,7-8,17,19H,2,5-6,9-15H2/b19-18+ |
| InChIKey | AEAUEQDJTHKJBN-VHEBQXMUSA-N |
| XLogP | 3.36 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|