C20H23N3 — CID 58853501
1-phenyl-2-[4-(piperidin-1-ylmethyl)phenyl]ethane-1,2-diimine (PubChem CID 58853501) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-phenyl-2-[4-(piperidin-1-ylmethyl)phenyl]ethane-1,2-diimine.
| Compound Name | 1-phenyl-2-[4-(piperidin-1-ylmethyl)phenyl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 58853501 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1-phenyl-2-[4-(piperidin-1-ylmethyl)phenyl]ethane-1,2-diimine |
| SMILES | [H]/N=C(C(=N/[H])/c1ccc(CN2CCCCC2)cc1)\c1ccccc1 |
| InChI | InChI=1S/C20H23N3/c21-19(17-7-3-1-4-8-17)20(22)18-11-9-16(10-12-18)15-23-13-5-2-6-14-23/h1,3-4,7-12,21-22H,2,5-6,13-15H2/b21-19+,22-20+ |
| InChIKey | FSLDKLWEEQVTGI-FLFKKZLDSA-N |
| XLogP | 4.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|