C17H17ClN2S — CID 5066117
N-(2-chlorophenyl)-3-phenylpyrrolidine-1-carbothioamide (PubChem CID 5066117) has the molecular formula C17H17ClN2S and a molecular weight of 316.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-phenylpyrrolidine-1-carbothioamide.
| Compound Name | N-(2-chlorophenyl)-3-phenylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 5066117 |
| Molecular Formula | C17H17ClN2S |
| Molecular Weight | 316.86 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-(2-chlorophenyl)-3-phenylpyrrolidine-1-carbothioamide |
| SMILES | S=C(Nc1ccccc1Cl)N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C17H17ClN2S/c18-15-8-4-5-9-16(15)19-17(21)20-11-10-14(12-20)13-6-2-1-3-7-13/h1-9,14H,10-12H2,(H,19,21) |
| InChIKey | JKBAMUKXKNEXLN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|