C19H28ClN3S — CID 5216672
N-(2-chlorophenyl)-4-[cyclohexyl(methyl)amino]piperidine-1-carbothioamide (PubChem CID 5216672) has the molecular formula C19H28ClN3S and a molecular weight of 365.97 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[cyclohexyl(methyl)amino]piperidine-1-carbothioamide.
| Compound Name | N-(2-chlorophenyl)-4-[cyclohexyl(methyl)amino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 5216672 |
| Molecular Formula | C19H28ClN3S |
| Molecular Weight | 365.97 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(2-chlorophenyl)-4-[cyclohexyl(methyl)amino]piperidine-1-carbothioamide |
| SMILES | CN(C1CCCCC1)C1CCN(C(=S)Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H28ClN3S/c1-22(15-7-3-2-4-8-15)16-11-13-23(14-12-16)19(24)21-18-10-6-5-9-17(18)20/h5-6,9-10,15-16H,2-4,7-8,11-14H2,1H3,(H,21,24) |
| InChIKey | QNGQMUWRPDNPPL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.97 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|