C23H30ClN3OS — CID 3218721
N-[1-[(2-chlorophenyl)carbamothioyl]piperidin-4-yl]adamantane-1-carboxamide (PubChem CID 3218721) has the molecular formula C23H30ClN3OS and a molecular weight of 432.03 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)carbamothioyl]piperidin-4-yl]adamantane-1-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)carbamothioyl]piperidin-4-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3218721 |
| Molecular Formula | C23H30ClN3OS |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[1-[(2-chlorophenyl)carbamothioyl]piperidin-4-yl]adamantane-1-carboxamide |
| SMILES | O=C(NC1CCN(C(=S)Nc2ccccc2Cl)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H30ClN3OS/c24-19-3-1-2-4-20(19)26-22(29)27-7-5-18(6-8-27)25-21(28)23-12-15-9-16(13-23)11-17(10-15)14-23/h1-4,15-18H,5-14H2,(H,25,28)(H,26,29) |
| InChIKey | UMUGWHYRLTXCTC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|