C25H33N3O2S — CID 54787541
N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide (PubChem CID 54787541) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide.
| Compound Name | N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 54787541 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]adamantane-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1ccccc1NC(=S)NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H33N3O2S/c29-22(26-19-6-2-1-3-7-19)20-8-4-5-9-21(20)27-24(31)28-23(30)25-13-16-10-17(14-25)12-18(11-16)15-25/h4-5,8-9,16-19H,1-3,6-7,10-15H2,(H,26,29)(H2,27,28,30,31) |
| InChIKey | JIBQZSPPLILUSR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|