C28H34N2O3 — CID 5298274
5-(1-adamantyl)-N-[2-(cyclohexylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 5298274) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 5-(1-adamantyl)-N-[2-(cyclohexylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(1-adamantyl)-N-[2-(cyclohexylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5298274 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 5-(1-adamantyl)-N-[2-(cyclohexylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CCCCC1)c1ccc(C23CC4CC(CC(C4)C2)C3)o1 |
| InChI | InChI=1S/C28H34N2O3/c31-26(29-21-6-2-1-3-7-21)22-8-4-5-9-23(22)30-27(32)24-10-11-25(33-24)28-15-18-12-19(16-28)14-20(13-18)17-28/h4-5,8-11,18-21H,1-3,6-7,12-17H2,(H,29,31)(H,30,32) |
| InChIKey | RGBCJZRXHUFQKX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |